CAS 1000342-08-4 appears in our catalog under these names: 4-amino-2-(methoxycarbonyl)benzoic acid, >95% (HPLC), Apremilast Impurity 59. Offered by: TRC, Chemat Brand. Available pack sizes: 250mg, 500mg, 50mg, on request.
4-amino-2-methoxycarbonylbenzoic acid (CAS 1000342-08-4) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 4-amino-2-methoxycarbonylbenzoic acid. InChIKey: QYIMVQNDYUAYTM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 4-amino-2-methoxycarbonylbenzoic acid |
| InChIKey | QYIMVQNDYUAYTM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)N)C(=O)O |
Computed by PubChem (NCBI)