CAS 380566-25-6 appears in our catalog under these names: 5-(2-Fluorophenyl)furan-2-carbaldehyde 95+%, 5-(2-Fluoro-phenyl)-furan-2-carbaldehyde, 95+%. Offered by: Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-(2-fluorophenyl)furan-2-carbaldehyde (CAS 380566-25-6) is a chemical compound with the molecular formula C11H7FO2 and a molecular weight of 190.17 g/mol. IUPAC name: 5-(2-fluorophenyl)furan-2-carbaldehyde. InChIKey: KGGOAPVMWNGAQS-UHFFFAOYSA-N.
| Molecular formula | C11H7FO2 |
|---|---|
| Molecular weight | 190.17 g/mol |
| IUPAC name | 5-(2-fluorophenyl)furan-2-carbaldehyde |
| InChIKey | KGGOAPVMWNGAQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(O2)C=O)F |
Computed by PubChem (NCBI)