CAS 57476-59-2 appears in our catalog under these names: 4,6-Diphenyl-2,2'-bipyridine, 98%, 98%, 4,6-Diphenyl-2,2'-bipyridine, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,4-diphenyl-6-pyridin-2-ylpyridine (CAS 57476-59-2) is a chemical compound with the molecular formula C22H16N2 and a molecular weight of 308.4 g/mol. IUPAC name: 2,4-diphenyl-6-pyridin-2-ylpyridine. InChIKey: DEQJSUIBQNVOFU-UHFFFAOYSA-N.
| Molecular formula | C22H16N2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 2,4-diphenyl-6-pyridin-2-ylpyridine |
| InChIKey | DEQJSUIBQNVOFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=C2)C3=CC=CC=N3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)