Products 1666-86-0
CAS 1666-86-0 is the registry number for 2,4,6-Triphenylpyrimidine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4,6-triphenylpyrimidine (CAS 1666-86-0) is a chemical compound with the molecular formula C22H16N2 and a molecular weight of 308.4 g/mol. IUPAC name: 2,4,6-triphenylpyrimidine. InChIKey: SZKWMQWGJPCXOF-UHFFFAOYSA-N.
| Molecular formula | C22H16N2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 2,4,6-triphenylpyrimidine |
| InChIKey | SZKWMQWGJPCXOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)