Products 1000930-03-9
CAS 1000930-03-9 is the registry number for 1,3-Dimethyl-1-{3-methyl-(1,2)oxazolo(5,4-b)pyridine-5-carbonyl}urea. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N,3-dimethyl-N-(methylcarbamoyl)-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide (CAS 1000930-03-9) is a chemical compound with the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. IUPAC name: N,3-dimethyl-N-(methylcarbamoyl)-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide. InChIKey: JPIGBCHRVTUNBE-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O3 |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | N,3-dimethyl-N-(methylcarbamoyl)-[1,2]oxazolo[5,4-b]pyridine-5-carboxamide |
| InChIKey | JPIGBCHRVTUNBE-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C=C(C=N2)C(=O)N(C)C(=O)NC |
Computed by PubChem (NCBI)