CAS 1000932-07-9 is the registry number for 12-Oxa-2,3,5,7-tetraazatricyclo(7.4.0.0,2,6)trideca-1(9),3,5,7-tetraen-13-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
12-oxa-2,3,5,7-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-13-one (CAS 1000932-07-9) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 12-oxa-2,3,5,7-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-13-one. InChIKey: VTFYQBSWPWKVSM-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 12-oxa-2,3,5,7-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-13-one |
| InChIKey | VTFYQBSWPWKVSM-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C2=C1C=NC3=NC=NN23 |
Computed by PubChem (NCBI)