CAS 1029108-75-5 appears in our catalog under these names: 5-Pyrazin-2-yl-1H-pyrazole-3-carboxylic acid, 98%, 5-(Pyrazin-2-yl)-1H-pyrazole-3-carboxylic acid, 98%, 5–(Pyrazin–2–yl)–1H–pyrazole–3–carboxylic acid, 5-PYRAZIN-2-YL-1H-PYRAZOLE-3-CARBOXYLIC ACID, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 250mg, 100mg.
3-pyrazin-2-yl-1H-pyrazole-5-carboxylic acid (CAS 1029108-75-5) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 3-pyrazin-2-yl-1H-pyrazole-5-carboxylic acid. InChIKey: CRXNDMKZOCJVFF-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3-pyrazin-2-yl-1H-pyrazole-5-carboxylic acid |
| InChIKey | CRXNDMKZOCJVFF-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)