CAS 90220-88-5 appears in our catalog under these names: 1-(Pyridin-2-yl)-1h-1,2,4-triazole-3-carboxylic acid, 95%, 1-(Pyridin-2-yl)-1H-1,2,4-triazole-3-carboxylic acid, 95+%, 1-(2-PYRIDINYL)-1H-1,2,4-TRIAZOLE-3-CARBOXYLIC ACID, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g.
1-pyridin-2-yl-1,2,4-triazole-3-carboxylic acid (CAS 90220-88-5) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 1-pyridin-2-yl-1,2,4-triazole-3-carboxylic acid. InChIKey: HPLFJBWLUZPHFX-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 1-pyridin-2-yl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | HPLFJBWLUZPHFX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)N2C=NC(=N2)C(=O)O |
Computed by PubChem (NCBI)