CAS 25688-22-6 appears in our catalog under these names: 1-(2-Nitrophenyl)-1h-1,2,4-triazole, 95%, 1-(2-Nitrophenyl)-1H-1,2,4-triazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
1-(2-nitrophenyl)-1,2,4-triazole (CAS 25688-22-6) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 1-(2-nitrophenyl)-1,2,4-triazole. InChIKey: VRTXNVSANZBXNW-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 1-(2-nitrophenyl)-1,2,4-triazole |
| InChIKey | VRTXNVSANZBXNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=NC=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)