CAS 1060796-15-7 appears in our catalog under these names: 6-(4H-1,2,4-Triazol-4-yl)-2-pyridinecarboxylic acid, 95%, 6-(4H-1,2,4-Triazol-4-yl)picolinic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
6-(1,2,4-triazol-4-yl)pyridine-2-carboxylic acid (CAS 1060796-15-7) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 6-(1,2,4-triazol-4-yl)pyridine-2-carboxylic acid. InChIKey: YTGGSAPHQNMVJC-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 6-(1,2,4-triazol-4-yl)pyridine-2-carboxylic acid |
| InChIKey | YTGGSAPHQNMVJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)N2C=NN=C2)C(=O)O |
Computed by PubChem (NCBI)