CAS 6219-54-1 is the registry number for 5-(2-Nitrophenyl)-1h-1,2,4-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
5-(2-nitrophenyl)-1H-1,2,4-triazole (CAS 6219-54-1) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 5-(2-nitrophenyl)-1H-1,2,4-triazole. InChIKey: UGKSLQJFMFZZGL-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 5-(2-nitrophenyl)-1H-1,2,4-triazole |
| InChIKey | UGKSLQJFMFZZGL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=NN2)[N+](=O)[O-] |
Computed by PubChem (NCBI)