CAS 2704950-85-4 is the registry number for (R)-Methyl 2-(piperazin-2-yl)acetate dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Methyl 2-[(2R)-piperazin-2-yl]acetate;dihydrochloride (CAS 2704950-85-4) is a chemical compound with the molecular formula C7H16Cl2N2O2 and a molecular weight of 231.12 g/mol. IUPAC name: methyl 2-[(2R)-piperazin-2-yl]acetate;dihydrochloride. InChIKey: BAKVEPAYECKEHR-QYCVXMPOSA-N.
| Molecular formula | C7H16Cl2N2O2 |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | methyl 2-[(2R)-piperazin-2-yl]acetate;dihydrochloride |
| InChIKey | BAKVEPAYECKEHR-QYCVXMPOSA-N |
| SMILES | COC(=O)C[C@@H]1CNCCN1.Cl.Cl |
Computed by PubChem (NCBI)