CAS 100219-71-4 is the registry number for (6-Bromo-2-oxo-1,3-benzoxazol-3(2H)-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
2-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)acetic acid (CAS 100219-71-4) is a chemical compound with the molecular formula C9H6BrNO4 and a molecular weight of 272.05 g/mol. IUPAC name: 2-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)acetic acid. InChIKey: SQNUVNXWEMZEKN-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO4 |
|---|---|
| Molecular weight | 272.05 g/mol |
| IUPAC name | 2-(6-bromo-2-oxo-1,3-benzoxazol-3-yl)acetic acid |
| InChIKey | SQNUVNXWEMZEKN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)OC(=O)N2CC(=O)O |
Computed by PubChem (NCBI)