CAS 1344891-41-3 is the registry number for 6-Bromo-8-nitro-3,4-dihydro-2H-1-benzopyran-4-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-bromo-8-nitro-2,3-dihydrochromen-4-one (CAS 1344891-41-3) is a chemical compound with the molecular formula C9H6BrNO4 and a molecular weight of 272.05 g/mol. IUPAC name: 6-bromo-8-nitro-2,3-dihydrochromen-4-one. InChIKey: PSFMGAPKAQACDX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO4 |
|---|---|
| Molecular weight | 272.05 g/mol |
| IUPAC name | 6-bromo-8-nitro-2,3-dihydrochromen-4-one |
| InChIKey | PSFMGAPKAQACDX-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)C=C(C=C2[N+](=O)[O-])Br |
Computed by PubChem (NCBI)