CAS 90792-61-3 is the registry number for 4-Bromo-7-hydroxy-6-nitro-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-7-hydroxy-6-nitro-2,3-dihydroinden-1-one (CAS 90792-61-3) is a chemical compound with the molecular formula C9H6BrNO4 and a molecular weight of 272.05 g/mol. IUPAC name: 4-bromo-7-hydroxy-6-nitro-2,3-dihydroinden-1-one. InChIKey: QFIBPCFIYFLJPM-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO4 |
|---|---|
| Molecular weight | 272.05 g/mol |
| IUPAC name | 4-bromo-7-hydroxy-6-nitro-2,3-dihydroinden-1-one |
| InChIKey | QFIBPCFIYFLJPM-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C(C(=CC(=C21)Br)[N+](=O)[O-])O |
Computed by PubChem (NCBI)