CAS 1427368-55-5 is the registry number for 5-Bromo-4-methoxyisatoic anhydride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
6-bromo-7-methoxy-1H-3,1-benzoxazine-2,4-dione (CAS 1427368-55-5) is a chemical compound with the molecular formula C9H6BrNO4 and a molecular weight of 272.05 g/mol. IUPAC name: 6-bromo-7-methoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: SLROETCLRZEZHV-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO4 |
|---|---|
| Molecular weight | 272.05 g/mol |
| IUPAC name | 6-bromo-7-methoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | SLROETCLRZEZHV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)NC(=O)OC2=O)Br |
Computed by PubChem (NCBI)