CAS 1094298-69-7 is the registry number for 6-Bromo-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-bromo-3-oxo-4H-1,4-benzoxazine-7-carboxylic acid (CAS 1094298-69-7) is a chemical compound with the molecular formula C9H6BrNO4 and a molecular weight of 272.05 g/mol. IUPAC name: 6-bromo-3-oxo-4H-1,4-benzoxazine-7-carboxylic acid. InChIKey: HJUJCCYAKOLUSO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO4 |
|---|---|
| Molecular weight | 272.05 g/mol |
| IUPAC name | 6-bromo-3-oxo-4H-1,4-benzoxazine-7-carboxylic acid |
| InChIKey | HJUJCCYAKOLUSO-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)