Products 1094298-69-7

CAS 1094298-69-7 is the registry number for 6-Bromo-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

6-bromo-3-oxo-4H-1,4-benzoxazine-7-carboxylic acid (CAS 1094298-69-7) is a chemical compound with the molecular formula C9H6BrNO4 and a molecular weight of 272.05 g/mol. IUPAC name: 6-bromo-3-oxo-4H-1,4-benzoxazine-7-carboxylic acid. InChIKey: HJUJCCYAKOLUSO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6BrNO4
Molecular weight272.05 g/mol
IUPAC name6-bromo-3-oxo-4H-1,4-benzoxazine-7-carboxylic acid
InChIKeyHJUJCCYAKOLUSO-UHFFFAOYSA-N
SMILESC1C(=O)NC2=C(O1)C=C(C(=C2)Br)C(=O)O

Computed by PubChem (NCBI)