Products 1221792-66-0

CAS 1221792-66-0 is the registry number for Methyl 5-bromo-2-oxo-2,3-dihydro-1,3-benzoxazole-7-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 5-bromo-2-oxo-3H-1,3-benzoxazole-7-carboxylate (CAS 1221792-66-0) is a chemical compound with the molecular formula C9H6BrNO4 and a molecular weight of 272.05 g/mol. IUPAC name: methyl 5-bromo-2-oxo-3H-1,3-benzoxazole-7-carboxylate. InChIKey: BEDHRJIQJQSKFR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6BrNO4
Molecular weight272.05 g/mol
IUPAC namemethyl 5-bromo-2-oxo-3H-1,3-benzoxazole-7-carboxylate
InChIKeyBEDHRJIQJQSKFR-UHFFFAOYSA-N
SMILESCOC(=O)C1=C2C(=CC(=C1)Br)NC(=O)O2

Computed by PubChem (NCBI)