CAS 100286-97-3 appears in our catalog under these names: Milrinone lactate, 95%, Milrinone Lactate, >95% (HPLC), Milrinone lactate, Milrinone (lactate), 98.08%. Offered by: Combi-blocks, TRC, Biosynth, MedChemExpress. Available pack sizes: 1g, 250mg, 200mg, 25mg, 50mg, 10g, 100 mg, 25 mg.
2-hydroxypropanoic acid;6-methyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile (CAS 100286-97-3) is a chemical compound with the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. IUPAC name: 2-hydroxypropanoic acid;6-methyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile. InChIKey: VWUPWEAFIOQCGF-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O4 |
|---|---|
| Molecular weight | 301.30 g/mol |
| IUPAC name | 2-hydroxypropanoic acid;6-methyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile |
| InChIKey | VWUPWEAFIOQCGF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=O)N1)C#N)C2=CC=NC=C2.CC(C(=O)O)O |
Computed by PubChem (NCBI)