CAS 569355-36-8 is the registry number for Formoterol Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
3-morpholin-4-yl-1-(4-nitrophenyl)pyridin-2-one (CAS 569355-36-8) is a chemical compound with the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. IUPAC name: 3-morpholin-4-yl-1-(4-nitrophenyl)pyridin-2-one. InChIKey: HVSZCAQTDXYLKK-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O4 |
|---|---|
| Molecular weight | 301.30 g/mol |
| IUPAC name | 3-morpholin-4-yl-1-(4-nitrophenyl)pyridin-2-one |
| InChIKey | HVSZCAQTDXYLKK-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=CN(C2=O)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)