CAS 2766180-42-9 is the registry number for 3-(6-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)-1H-indol-1-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[6-(2,4-dioxo-1,3-diazinan-1-yl)indol-1-yl]propanoic acid (CAS 2766180-42-9) is a chemical compound with the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. IUPAC name: 3-[6-(2,4-dioxo-1,3-diazinan-1-yl)indol-1-yl]propanoic acid. InChIKey: GVQRRPUQSUJIND-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O4 |
|---|---|
| Molecular weight | 301.30 g/mol |
| IUPAC name | 3-[6-(2,4-dioxo-1,3-diazinan-1-yl)indol-1-yl]propanoic acid |
| InChIKey | GVQRRPUQSUJIND-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC3=C(C=C2)C=CN3CCC(=O)O |
Computed by PubChem (NCBI)