CAS 725698-74-8 is the registry number for 3-({(1-(2-Methoxyphenyl)ethylidene)amino}oxy)-5-nitroaniline. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-[(E)-1-(2-methoxyphenyl)ethylideneamino]oxy-5-nitroaniline (CAS 725698-74-8) is a chemical compound with the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. IUPAC name: 3-[(E)-1-(2-methoxyphenyl)ethylideneamino]oxy-5-nitroaniline. InChIKey: JUWVEZYWYJSXFC-LICLKQGHSA-N.
| Molecular formula | C15H15N3O4 |
|---|---|
| Molecular weight | 301.30 g/mol |
| IUPAC name | 3-[(E)-1-(2-methoxyphenyl)ethylideneamino]oxy-5-nitroaniline |
| InChIKey | JUWVEZYWYJSXFC-LICLKQGHSA-N |
| SMILES | C/C(=N\OC1=CC(=CC(=C1)[N+](=O)[O-])N)/C2=CC=CC=C2OC |
Computed by PubChem (NCBI)