CAS 136544-11-1 is the registry number for YM 934. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,2-dimethyl-6-nitro-4-(1-oxidopyridin-1-ium-2-yl)-3H-1,4-benzoxazine (CAS 136544-11-1) is a chemical compound with the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. IUPAC name: 2,2-dimethyl-6-nitro-4-(1-oxidopyridin-1-ium-2-yl)-3H-1,4-benzoxazine. InChIKey: GOTJEXSHEQBBSV-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O4 |
|---|---|
| Molecular weight | 301.30 g/mol |
| IUPAC name | 2,2-dimethyl-6-nitro-4-(1-oxidopyridin-1-ium-2-yl)-3H-1,4-benzoxazine |
| InChIKey | GOTJEXSHEQBBSV-UHFFFAOYSA-N |
| SMILES | CC1(CN(C2=C(O1)C=CC(=C2)[N+](=O)[O-])C3=CC=CC=[N+]3[O-])C |
Computed by PubChem (NCBI)