CAS 52551-07-2 appears in our catalog under these names: H–Tyr–pNA, H-L-Tyr-pNA, H-Tyr-pNA, 95%, 95%, H-Tyr-pNA, 95%. Offered by: GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 500mg.
(2S)-2-amino-3-(4-hydroxyphenyl)-N-(4-nitrophenyl)propanamide (CAS 52551-07-2) is a chemical compound with the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxyphenyl)-N-(4-nitrophenyl)propanamide. InChIKey: TVHHNERSENUVQJ-AWEZNQCLSA-N.
| Molecular formula | C15H15N3O4 |
|---|---|
| Molecular weight | 301.30 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxyphenyl)-N-(4-nitrophenyl)propanamide |
| InChIKey | TVHHNERSENUVQJ-AWEZNQCLSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)NC2=CC=C(C=C2)[N+](=O)[O-])N)O |
Computed by PubChem (NCBI)