CAS 100306-70-5 is the registry number for 4-Benzylamino-3-nitropyridine. Offered by: Chemat. Available pack sizes: 1g.
N-benzyl-3-nitropyridin-4-amine (CAS 100306-70-5) is a chemical compound with the molecular formula C12H11N3O2 and a molecular weight of 229.23 g/mol. IUPAC name: N-benzyl-3-nitropyridin-4-amine. InChIKey: MEVVLVNFFGTNKY-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O2 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | N-benzyl-3-nitropyridin-4-amine |
| InChIKey | MEVVLVNFFGTNKY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=NC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)