CAS 1003561-80-5 appears in our catalog under these names: 5-(2-(Trifluoromethyl)phenyl)-1,2-oxazole-4-carboxylic acid, 95%, 5-(2-(Trifluoromethyl)phenyl)-1,2-oxazole-4-carboxylic Acid. Offered by: AmBeed, TRC, Biosynth. Available pack sizes: 5g, 100mg, 10mg, 50mg, 0,5g.
5-[2-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxylic acid (CAS 1003561-80-5) is a chemical compound with the molecular formula C11H6F3NO3 and a molecular weight of 257.16 g/mol. IUPAC name: 5-[2-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxylic acid. InChIKey: QOCRUEFJYFMYAM-UHFFFAOYSA-N.
| Molecular formula | C11H6F3NO3 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 5-[2-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxylic acid |
| InChIKey | QOCRUEFJYFMYAM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=C(C=NO2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)