Products 1003709-47-4
CAS 1003709-47-4 appears in our catalog under these names: 2–Bromo–4–fluoro–6–methylbenzoic acid, 2-Bromo-4-fluoro-6-methylbenzoic acid, 2-Bromo-4-fluoro-6-methylbenzoic acid 97%, 2-Bromo-4-fluoro-6-methylbenzoic acid, 97%, 2-Bromo-4-fluoro-6-methylbenzoic acid, 97%, 97%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 2,5g, 10g, 25g, 100g, 100mg.
2-bromo-4-fluoro-6-methylbenzoic acid (CAS 1003709-47-4) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-bromo-4-fluoro-6-methylbenzoic acid. InChIKey: VOFBSAUUUDKWGR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-bromo-4-fluoro-6-methylbenzoic acid |
| InChIKey | VOFBSAUUUDKWGR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)Br)F |
Computed by PubChem (NCBI)