CAS 1003709-54-3 appears in our catalog under these names: 2-Bromo-5-fluoro-4-methylbenzoic acid, 97%, 2–Bromo–5–fluoro–4–methylbenzoic acid, 2-Bromo-5-fluoro-4-methylbenzoic acid, 97%, 97%, 2-BROMO-5-FLUORO-4-METHYLBENZOIC ACID, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 25g, 1g, 10g, 250mg, 100mg.
2-bromo-5-fluoro-4-methylbenzoic acid (CAS 1003709-54-3) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-bromo-5-fluoro-4-methylbenzoic acid. InChIKey: WFPYJWBPQCXYCJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-bromo-5-fluoro-4-methylbenzoic acid |
| InChIKey | WFPYJWBPQCXYCJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)C(=O)O)Br |
Computed by PubChem (NCBI)