CAS 1003932-04-4 is the registry number for Dimethyl 2-chloropyridine-3,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 2-chloropyridine-3,5-dicarboxylate (CAS 1003932-04-4) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: dimethyl 2-chloropyridine-3,5-dicarboxylate. InChIKey: ACUVULBLRYYPMU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO4 |
|---|---|
| Molecular weight | 229.62 g/mol |
| IUPAC name | dimethyl 2-chloropyridine-3,5-dicarboxylate |
| InChIKey | ACUVULBLRYYPMU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)