Products 1003932-04-4

CAS 1003932-04-4 is the registry number for Dimethyl 2-chloropyridine-3,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Dimethyl 2-chloropyridine-3,5-dicarboxylate (CAS 1003932-04-4) is a chemical compound with the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. IUPAC name: dimethyl 2-chloropyridine-3,5-dicarboxylate. InChIKey: ACUVULBLRYYPMU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClNO4
Molecular weight229.62 g/mol
IUPAC namedimethyl 2-chloropyridine-3,5-dicarboxylate
InChIKeyACUVULBLRYYPMU-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(N=C1)Cl)C(=O)OC

Computed by PubChem (NCBI)