Products 100394-14-7

CAS 100394-14-7 is the registry number for 3-(Naphthalene-2-sulfonylamino)propionic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

3-(naphthalen-2-ylsulfonylamino)propanoic acid (CAS 100394-14-7) is a chemical compound with the molecular formula C13H13NO4S and a molecular weight of 279.31 g/mol. IUPAC name: 3-(naphthalen-2-ylsulfonylamino)propanoic acid. InChIKey: ZARBMGXIZPSUAL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO4S
Molecular weight279.31 g/mol
IUPAC name3-(naphthalen-2-ylsulfonylamino)propanoic acid
InChIKeyZARBMGXIZPSUAL-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C=CC2=C1)S(=O)(=O)NCCC(=O)O

Computed by PubChem (NCBI)