CAS 82228-89-5 appears in our catalog under these names: N-Methylpyridinium-4-carboxaldehyde benzenesulfonate hydrate, 95%, 4-Formyl-1-methyl-pyridinium benzenesulfonate, 96%, 4–Formyl–1–methylpyridin–1–ium benzenesulfonate, N-Methylpyridinium-4-carboxaldehyde benzenesulfonate hydrate, 4-Formyl-1-methylpyridin-1-ium benzenesulfonate 98% (contains hydrate). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 25g, 100g, 5g, 10g.
Benzenesulfonate;1-methylpyridin-1-ium-4-carbaldehyde (CAS 82228-89-5) is a chemical compound with the molecular formula C13H13NO4S and a molecular weight of 279.31 g/mol. IUPAC name: benzenesulfonate;1-methylpyridin-1-ium-4-carbaldehyde. InChIKey: HSVLGIFAXFDLMU-UHFFFAOYSA-M.
| Molecular formula | C13H13NO4S |
|---|---|
| Molecular weight | 279.31 g/mol |
| IUPAC name | benzenesulfonate;1-methylpyridin-1-ium-4-carbaldehyde |
| InChIKey | HSVLGIFAXFDLMU-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC=C(C=C1)C=O.C1=CC=C(C=C1)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)