Products 123760-47-4
CAS 123760-47-4 appears in our catalog under these names: (Methyl(2-naphthylsulfonyl)amino)acetic acid, 95%, 2-(N-Methylnaphthalene-2-sulfonamido)acetic acid, 97%, 2-(N-Methylnaphthalene-2-sulfonamido)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 0,5g.
2-[methyl(naphthalen-2-ylsulfonyl)amino]acetic acid (CAS 123760-47-4) is a chemical compound with the molecular formula C13H13NO4S and a molecular weight of 279.31 g/mol. IUPAC name: 2-[methyl(naphthalen-2-ylsulfonyl)amino]acetic acid. InChIKey: ZBJPWSYUZNLAFO-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4S |
|---|---|
| Molecular weight | 279.31 g/mol |
| IUPAC name | 2-[methyl(naphthalen-2-ylsulfonyl)amino]acetic acid |
| InChIKey | ZBJPWSYUZNLAFO-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)S(=O)(=O)C1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)