Products 400080-46-8

CAS 400080-46-8 is the registry number for 2-(3,4-Dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 400080-46-8) is a chemical compound with the molecular formula C13H13NO4S and a molecular weight of 279.31 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: XLOKWLWQQDZOIT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO4S
Molecular weight279.31 g/mol
IUPAC name2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid
InChIKeyXLOKWLWQQDZOIT-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)C2=CC(=C(C=C2)OC)OC)C(=O)O

Computed by PubChem (NCBI)