CAS 400080-46-8 is the registry number for 2-(3,4-Dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 400080-46-8) is a chemical compound with the molecular formula C13H13NO4S and a molecular weight of 279.31 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: XLOKWLWQQDZOIT-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4S |
|---|---|
| Molecular weight | 279.31 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | XLOKWLWQQDZOIT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)OC)OC)C(=O)O |
Computed by PubChem (NCBI)