Products 330967-96-9

CAS 330967-96-9 is the registry number for N-(Methylsulfonyl)-n-1-naphthylglycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[methylsulfonyl(naphthalen-1-yl)amino]acetic acid (CAS 330967-96-9) is a chemical compound with the molecular formula C13H13NO4S and a molecular weight of 279.31 g/mol. IUPAC name: 2-[methylsulfonyl(naphthalen-1-yl)amino]acetic acid. InChIKey: VVNZXHNUHNUENW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO4S
Molecular weight279.31 g/mol
IUPAC name2-[methylsulfonyl(naphthalen-1-yl)amino]acetic acid
InChIKeyVVNZXHNUHNUENW-UHFFFAOYSA-N
SMILESCS(=O)(=O)N(CC(=O)O)C1=CC=CC2=CC=CC=C21

Computed by PubChem (NCBI)