Products 350030-47-6

CAS 350030-47-6 is the registry number for 2-[(1-Ethyl-2,5-dioxopyrrolidin-3-yl)thio]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid (CAS 350030-47-6) is a chemical compound with the molecular formula C13H13NO4S and a molecular weight of 279.31 g/mol. IUPAC name: 2-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid. InChIKey: RDPIPPDYPKSJQA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO4S
Molecular weight279.31 g/mol
IUPAC name2-(1-ethyl-2,5-dioxopyrrolidin-3-yl)sulfanylbenzoic acid
InChIKeyRDPIPPDYPKSJQA-UHFFFAOYSA-N
SMILESCCN1C(=O)CC(C1=O)SC2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)