CAS 1004192-90-8 is the registry number for 1-((4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl)-1H-pyrazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carboxylic acid (CAS 1004192-90-8) is a chemical compound with the molecular formula C10H11ClN4O2 and a molecular weight of 254.67 g/mol. IUPAC name: 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carboxylic acid. InChIKey: WDLROUFCNIEHEV-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4O2 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 1-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]pyrazole-3-carboxylic acid |
| InChIKey | WDLROUFCNIEHEV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CN2C=CC(=N2)C(=O)O)C)Cl |
Computed by PubChem (NCBI)