CAS 99951-44-7 is the registry number for Methyl 7-chloro-5-(propan-2-yl)-(1,2,4)triazolo(1,5-a)pyrimidine-2-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (CAS 99951-44-7) is a chemical compound with the molecular formula C10H11ClN4O2 and a molecular weight of 254.67 g/mol. IUPAC name: methyl 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate. InChIKey: BIPTTZMZSCIYMX-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4O2 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | methyl 7-chloro-5-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| InChIKey | BIPTTZMZSCIYMX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=NC(=NN2C(=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)