CAS 101336-63-4 is the registry number for 2-Chloro-5-((2-(nitromethylene)-1-imidazolidinyl)methyl)pyridine. Offered by: TRC. Available pack sizes: 100mg, 1g.
2-chloro-5-[[2-(nitromethylidene)imidazolidin-1-yl]methyl]pyridine (CAS 101336-63-4) is a chemical compound with the molecular formula C10H11ClN4O2 and a molecular weight of 254.67 g/mol. IUPAC name: 2-chloro-5-[[2-(nitromethylidene)imidazolidin-1-yl]methyl]pyridine. InChIKey: ALNDHUQPXHHNON-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4O2 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 2-chloro-5-[[2-(nitromethylidene)imidazolidin-1-yl]methyl]pyridine |
| InChIKey | ALNDHUQPXHHNON-UHFFFAOYSA-N |
| SMILES | C1CN(C(=C[N+](=O)[O-])N1)CC2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)