CAS 1803601-84-4 appears in our catalog under these names: 5-Methyl-1-(pyridin-4-ylmethyl)-1H-1,2,3-triazole-4-carboxylic acid hydrochloride, 5-Methyl-1-(pyridin-4-ylmethyl)-1H-1,2,3-triazole-4-carboxylic acid hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
5-methyl-1-(pyridin-4-ylmethyl)triazole-4-carboxylic acid;hydrochloride (CAS 1803601-84-4) is a chemical compound with the molecular formula C10H11ClN4O2 and a molecular weight of 254.67 g/mol. IUPAC name: 5-methyl-1-(pyridin-4-ylmethyl)triazole-4-carboxylic acid;hydrochloride. InChIKey: ZGLIXTHPKWKKOG-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4O2 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 5-methyl-1-(pyridin-4-ylmethyl)triazole-4-carboxylic acid;hydrochloride |
| InChIKey | ZGLIXTHPKWKKOG-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1CC2=CC=NC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)