CAS 2279123-49-6 is the registry number for 4-[5-(Aminomethyl)-1,2,4-oxadiazol-3-yl]benzamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]benzamide;hydrochloride (CAS 2279123-49-6) is a chemical compound with the molecular formula C10H11ClN4O2 and a molecular weight of 254.67 g/mol. IUPAC name: 4-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]benzamide;hydrochloride. InChIKey: XDNCQXBMQPLOPI-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4O2 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 4-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]benzamide;hydrochloride |
| InChIKey | XDNCQXBMQPLOPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CN)C(=O)N.Cl |
Computed by PubChem (NCBI)