CAS 2768158-27-4 is the registry number for Methyl 2-chloro-7-isopropyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chloro-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (CAS 2768158-27-4) is a chemical compound with the molecular formula C10H11ClN4O2 and a molecular weight of 254.67 g/mol. IUPAC name: methyl 2-chloro-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate. InChIKey: VNMSFQGZBKLXHK-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4O2 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | methyl 2-chloro-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| InChIKey | VNMSFQGZBKLXHK-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=NC2=NC(=NN12)Cl)C(=O)OC |
Computed by PubChem (NCBI)