CAS 1004417-78-0 is the registry number for 1-{(1-(propan-2-yl)-1H-pyrazol-5-yl)imino}-1H-isoindol-3-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(3Z)-3-(2-propan-2-ylpyrazol-3-yl)iminoisoindol-1-amine (CAS 1004417-78-0) is a chemical compound with the molecular formula C14H15N5 and a molecular weight of 253.30 g/mol. IUPAC name: (3Z)-3-(2-propan-2-ylpyrazol-3-yl)iminoisoindol-1-amine. InChIKey: ZKTXPQQBUQOAGW-UHFFFAOYSA-N.
| Molecular formula | C14H15N5 |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | (3Z)-3-(2-propan-2-ylpyrazol-3-yl)iminoisoindol-1-amine |
| InChIKey | ZKTXPQQBUQOAGW-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=CC=N1)/N=C\2/C3=CC=CC=C3C(=N2)N |
Computed by PubChem (NCBI)