CAS 1410614-33-3 appears in our catalog under these names: 9-((3,5-Dimethylphenyl)methyl)-9H-purin-6-amine, 95%, 9-((3,5-Dimethylphenyl)methyl)-9H-purin-6-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
9-[(3,5-dimethylphenyl)methyl]purin-6-amine (CAS 1410614-33-3) is a chemical compound with the molecular formula C14H15N5 and a molecular weight of 253.30 g/mol. IUPAC name: 9-[(3,5-dimethylphenyl)methyl]purin-6-amine. InChIKey: YKWWCXRVPZWQFS-UHFFFAOYSA-N.
| Molecular formula | C14H15N5 |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | 9-[(3,5-dimethylphenyl)methyl]purin-6-amine |
| InChIKey | YKWWCXRVPZWQFS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)CN2C=NC3=C(N=CN=C32)N)C |
Computed by PubChem (NCBI)