CAS 1154214-13-7 appears in our catalog under these names: 4-({5,7-dimethyl-(1,2,4)triazolo(4,3-a)pyrimidin-3-yl}methyl)aniline, 95%, 4-({5,7-Dimethyl-(1,2,4)triazolo(4,3-a)pyrimidin-3-yl}methyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]aniline (CAS 1154214-13-7) is a chemical compound with the molecular formula C14H15N5 and a molecular weight of 253.30 g/mol. IUPAC name: 4-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]aniline. InChIKey: ZRSKVYAHLYNIRS-UHFFFAOYSA-N.
| Molecular formula | C14H15N5 |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | 4-[(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)methyl]aniline |
| InChIKey | ZRSKVYAHLYNIRS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NN=C(N12)CC3=CC=C(C=C3)N)C |
Computed by PubChem (NCBI)