CAS 1274765-20-6 is the registry number for 9-((2,5-Dimethylphenyl)methyl)-9H-purin-6-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
9-[(2,5-dimethylphenyl)methyl]purin-6-amine (CAS 1274765-20-6) is a chemical compound with the molecular formula C14H15N5 and a molecular weight of 253.30 g/mol. IUPAC name: 9-[(2,5-dimethylphenyl)methyl]purin-6-amine. InChIKey: DBMOUMUFUNSNNM-UHFFFAOYSA-N.
| Molecular formula | C14H15N5 |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | 9-[(2,5-dimethylphenyl)methyl]purin-6-amine |
| InChIKey | DBMOUMUFUNSNNM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)CN2C=NC3=C(N=CN=C32)N |
Computed by PubChem (NCBI)