CAS 1006348-74-8 is the registry number for 4-(3-(1,3-Dimethyl-1H-pyrazol-4-yl)-1H-pyrazol-1-yl)aniline. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
4-[3-(1,3-dimethylpyrazol-4-yl)pyrazol-1-yl]aniline (CAS 1006348-74-8) is a chemical compound with the molecular formula C14H15N5 and a molecular weight of 253.30 g/mol. IUPAC name: 4-[3-(1,3-dimethylpyrazol-4-yl)pyrazol-1-yl]aniline. InChIKey: VLFQPHYGYFILEH-UHFFFAOYSA-N.
| Molecular formula | C14H15N5 |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | 4-[3-(1,3-dimethylpyrazol-4-yl)pyrazol-1-yl]aniline |
| InChIKey | VLFQPHYGYFILEH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C2=NN(C=C2)C3=CC=C(C=C3)N)C |
Computed by PubChem (NCBI)