CAS 1281342-72-0 is the registry number for 1-(6-(p-Tolyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)ethanamine, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-[6-(4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethanamine (CAS 1281342-72-0) is a chemical compound with the molecular formula C14H15N5 and a molecular weight of 253.30 g/mol. IUPAC name: 1-[6-(4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethanamine. InChIKey: IIXXTPPPLNYPTC-UHFFFAOYSA-N.
| Molecular formula | C14H15N5 |
|---|---|
| Molecular weight | 253.30 g/mol |
| IUPAC name | 1-[6-(4-methylphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethanamine |
| InChIKey | IIXXTPPPLNYPTC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NN3C(=NN=C3C(C)N)C=C2 |
Computed by PubChem (NCBI)