CAS 1004455-71-3 appears in our catalog under these names: Sildenafil Impurity 176, 3-Isobutyl-1-methyl-4-nitro-1H-pyrazole-5-carboxylic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5000mg.
1-methyl-3-(2-methylpropyl)-4-nitropyrazole-5-carboxylic acid (CAS 1004455-71-3) is a chemical compound with the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. IUPAC name: 1-methyl-3-(2-methylpropyl)-4-nitropyrazole-5-carboxylic acid. InChIKey: GIYYGHMYUNYGKY-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O4 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 1-methyl-3-(2-methylpropyl)-4-nitropyrazole-5-carboxylic acid |
| InChIKey | GIYYGHMYUNYGKY-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=NN(C(=C1[N+](=O)[O-])C(=O)O)C |
Computed by PubChem (NCBI)