CAS 1004643-49-5 is the registry number for 5-Methyl-1-{(3-(trifluoromethyl)phenyl)methyl}-1H-pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-amine (CAS 1004643-49-5) is a chemical compound with the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. IUPAC name: 5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-amine. InChIKey: GAYJVRYWRNUKOD-UHFFFAOYSA-N.
| Molecular formula | C12H12F3N3 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrazol-3-amine |
| InChIKey | GAYJVRYWRNUKOD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1CC2=CC(=CC=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)