CAS 1307705-43-6 is the registry number for 3-Methyl-1-[4-(trifluoromethyl)benzyl]-1h-pyrazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
5-methyl-2-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-3-amine (CAS 1307705-43-6) is a chemical compound with the molecular formula C12H12F3N3 and a molecular weight of 255.24 g/mol. IUPAC name: 5-methyl-2-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-3-amine. InChIKey: OKZQFTVYPJEEGH-UHFFFAOYSA-N.
| Molecular formula | C12H12F3N3 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 5-methyl-2-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-3-amine |
| InChIKey | OKZQFTVYPJEEGH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)N)CC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)